AG68031
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 98% | in stock | $62.00 | $44.00 | - + | |
10mg | 98% | in stock | $80.00 | $56.00 | - + | |
25mg | 98% | in stock | $151.00 | $106.00 | - + | |
50mg | 98% | in stock | $270.00 | $189.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG68031 |
Chemical Name: | 5-benzo[1,3]dioxol-5-yl-N-(2-methylpropyl)penta-2,4-dienamide |
CAS Number: | 5950-12-9 |
Molecular Formula: | C16H19NO3 |
Molecular Weight: | 273.327 |
MDL Number: | MFCD15146947 |
SMILES: | CC(CNC(=O)/C=C/C=C/c1ccc2c(c1)OCO2)C |
Piperlonguminine is a versatile compound that finds wide application in chemical synthesis. As a natural product derived from the Piper species, it serves as a valuable building block in the creation of various organic compounds. In the realm of chemical synthesis, Piperlonguminine is utilized as a key intermediate for the construction of complex molecules with significant biological activities.Its unique chemical structure and reactivity make Piperlonguminine a prized component in diverse synthetic pathways. Chemists leverage its functional groups and stereochemistry to introduce specific molecular motifs and generate novel compounds with targeted properties. Whether employed in the production of pharmaceuticals, agrochemicals, or materials science, the strategic incorporation of Piperlonguminine enhances the efficiency and efficacy of synthetic processes.Furthermore, the robust nature of Piperlonguminine allows for diverse derivatization strategies, offering chemists a broad spectrum of possibilities for molecular modification and diversification. Its role in chemical synthesis extends beyond a mere intermediate, as it contributes to the strategic design and synthesis of intricate molecular structures with potential applications across various scientific disciplines.