AG67387
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $20.00 | $14.00 | - + | |
1g | 98% | in stock | $33.00 | $23.00 | - + | |
5g | 98% | in stock | $81.00 | $57.00 | - + | |
10g | 98% | in stock | $127.00 | $89.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG67387 |
Chemical Name: | 4'-Butylbiphenyl-4-carboxylic acid |
CAS Number: | 59662-46-3 |
Molecular Formula: | C17H18O2 |
Molecular Weight: | 254.3236 |
MDL Number: | MFCD00222812 |
SMILES: | CCCCc1ccc(cc1)c1ccc(cc1)C(=O)O |
Complexity: | 271 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 5 |
XLogP3: | 5.6 |
Journal of medicinal chemistry 20051201