AG72101
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $49.00 | $34.00 | - + | |
250mg | 97% | in stock | $65.00 | $45.00 | - + | |
1g | 97% | in stock | $165.00 | $115.00 | - + | |
5g | 97% | in stock | $573.00 | $401.00 | - + | |
10g | 97% | in stock | $962.00 | $673.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG72101 |
Chemical Name: | Dihydro Ketoprofen (Mixture of Diastereomers) |
CAS Number: | 59960-32-6 |
Molecular Formula: | C16H16O3 |
Molecular Weight: | 256.2964 |
MDL Number: | MFCD11977834 |
SMILES: | OC(=O)C(c1cccc(c1)C(c1ccccc1)O)C |