AG93392
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | 1 week | $86.00 | $60.00 | - + | |
250mg | 97% | 1 week | $140.00 | $98.00 | - + | |
1g | 97% | 1 week | $335.00 | $234.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG93392 |
Chemical Name: | 2,7-Dinitro-9,10-phenanthrenedione |
CAS Number: | 604-94-4 |
Molecular Formula: | C14H6N2O6 |
Molecular Weight: | 298.2072 |
MDL Number: | MFCD00701113 |
SMILES: | O=C1C(=O)c2cc(ccc2-c2c1cc(cc2)[N+](=O)[O-])[N+](=O)[O-] |
NSC Number: | 33530 |
Complexity: | 488 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 6 |
XLogP3: | 2.2 |
Journal of medicinal chemistry 20010524