AI53506
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $34.00 | $24.00 | - + | |
1g | 98% | in stock | $49.00 | $34.00 | - + | |
5g | 98% | in stock | $137.00 | $96.00 | - + | |
25g | 98% | in stock | $386.00 | $270.00 | - + | |
100g | 98% | in stock | $1,131.00 | $792.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI53506 |
Chemical Name: | Beta-nicotinamide adenine dinucleotide disodium salt hydrate, reduced form |
CAS Number: | 606-68-8 |
Molecular Formula: | C21H27N7Na2O14P2 |
Molecular Weight: | 709.4046420000002 |
MDL Number: | MFCD03791273 |
SMILES: | O[C@@H]1[C@H](O)[C@H](O[C@H]1N1C=CCC(=C1)C(=O)N)COP(=O)(OP(=O)(OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1ncnc2N)[O-])[O-].[Na+].[Na+] |
Complexity: | 1210 |
Covalently-Bonded Unit Count: | 3 |
Defined Atom Stereocenter Count: | 8 |
Heavy Atom Count: | 46 |
Hydrogen Bond Acceptor Count: | 19 |
Hydrogen Bond Donor Count: | 6 |
Rotatable Bond Count: | 11 |
Beta-Nicotinamide adenine dinucleotide disodium salt, also known as NADH, is a vital coenzyme found in living cells that plays a crucial role in energy production. In chemical synthesis, NADH serves as a powerful reducing agent, facilitating a wide range of reactions by donating electrons to substrates. This enables the conversion of various functional groups and the formation of new chemical bonds with high efficiency and specificity. Its versatility and biocompatibility make it a valuable tool in organic synthesis, pharmaceutical development, and biotechnology applications.