AG64120
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $16.00 | $11.00 | - + | |
5g | 98% | in stock | $18.00 | $12.00 | - + | |
10g | 98% | in stock | $20.00 | $14.00 | - + | |
25g | 98% | in stock | $33.00 | $23.00 | - + | |
100g | 98% | in stock | $123.00 | $86.00 | - + | |
250g | 98% | in stock | $295.00 | $207.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG64120 |
Chemical Name: | 1-Iodo-2-nitrobenzene |
CAS Number: | 609-73-4 |
Molecular Formula: | C6H4INO2 |
Molecular Weight: | 249.0059 |
MDL Number: | MFCD00007088 |
SMILES: | C1=CC=C(C(=C1)[N+](=O)[O-])I |
NSC Number: | 9793 |
Complexity: | 134 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
XLogP3: | 2.6 |
The Journal of organic chemistry 20080718
The journal of physical chemistry. A 20071011