AB70261
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
200mg | 97% | in stock | $93.00 | $65.00 | - + | |
1g | 97% | in stock | $226.00 | $158.00 | - + | |
5g | 97% | in stock | $721.00 | $505.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB70261 |
Chemical Name: | (10S,11S,14S)-14-hydroxytetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadeca-1,6-dien-5-one |
CAS Number: | 6218-29-7 |
Molecular Formula: | C18H24O2 |
Molecular Weight: | 272.382 |
MDL Number: | MFCD08457892 |
SMILES: | O=C1CCC2=C3CC[C@]4(C(C3CCC2=C1)CCC4O)C |
Complexity: | 528 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 1.8 |
Journal of medicinal chemistry 20041007