AB55072
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 95% | in stock | $11.00 | $8.00 | - + | |
25g | 95% | in stock | $30.00 | $21.00 | - + | |
100g | 95% | in stock | $106.00 | $75.00 | - + | |
500g | 95% | in stock | $413.00 | $290.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB55072 |
Chemical Name: | (+)-Diacetyl-l-tartaric anhydride |
CAS Number: | 6283-74-5 |
Molecular Formula: | C8H8O7 |
Molecular Weight: | 216.14491999999998 |
MDL Number: | MFCD00037918 |
SMILES: | CC(=O)O[C@H]1C(=O)OC(=O)[C@@H]1OC(=O)C |
Complexity: | 300 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 7 |
Rotatable Bond Count: | 4 |
XLogP3: | -0.4 |
Journal of chromatography. B, Analytical technologies in the biomedical and life sciences 20121015
Experimental diabetes research 20120101
PloS one 20110101
Talanta 20091015
Clinical chemistry 20040801
Chirality 20020801