AB54438
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 95% | in stock | $8.00 | $5.00 | - + | |
10g | 95% | in stock | $13.00 | $9.00 | - + | |
25g | 95% | in stock | $18.00 | $12.00 | - + | |
100g | 95% | in stock | $54.00 | $38.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB54438 |
Chemical Name: | Diisopropyl d-tartrate |
CAS Number: | 62961-64-2 |
Molecular Formula: | C10H18O6 |
Molecular Weight: | 234.2463 |
MDL Number: | MFCD00008876 |
SMILES: | O[C@@H]([C@@H](C(=O)OC(C)C)O)C(=O)OC(C)C |
Complexity: | 222 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 7 |
XLogP3: | 0.6 |
Journal of Zhejiang University. Science. B 20050601