AB58110
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $53.00 | $37.00 | - + | |
1g | 95% | in stock | $156.00 | $110.00 | - + | |
5g | 95% | in stock | $385.00 | $270.00 | - + | |
25g | 95% | in stock | $1,878.00 | $1,315.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB58110 |
Chemical Name: | 1-Bromoanthraquinone |
CAS Number: | 632-83-7 |
Molecular Formula: | C14H7BrO2 |
Molecular Weight: | 287.1082 |
MDL Number: | MFCD00451689 |
SMILES: | Brc1cccc2c1C(=O)c1ccccc1C2=O |
Complexity: | 352 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 2 |
XLogP3: | 4 |
The Journal of organic chemistry 20090703