AB44247
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 97% | in stock | $13.00 | $9.00 | - + | |
10g | 97% | in stock | $13.00 | $10.00 | - + | |
15g | 97% | in stock | $17.00 | $12.00 | - + | |
25g | 97% | in stock | $25.00 | $18.00 | - + | |
100g | 97% | in stock | $99.00 | $70.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB44247 |
Chemical Name: | 3-(4-Bromobenzoyl)propionic acid |
CAS Number: | 6340-79-0 |
Molecular Formula: | C10H9BrO3 |
Molecular Weight: | 257.0807 |
MDL Number: | MFCD00016563 |
SMILES: | O=C(c1ccc(cc1)Br)CCC(=O)O |
NSC Number: | 51068 |
Complexity: | 219 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 2.1 |
Acta pharmaceutica (Zagreb, Croatia) 20090601
Journal of medicinal chemistry 20081225