AB57832
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $65.00 | $45.00 | - + | |
250mg | 95% | in stock | $89.00 | $62.00 | - + | |
1g | 95% | in stock | $193.00 | $135.00 | - + | |
5g | 95% | in stock | $650.00 | $455.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB57832 |
Chemical Name: | 1-Amino-9h-fluoren-9-one |
CAS Number: | 6344-62-3 |
Molecular Formula: | C13H9NO |
Molecular Weight: | 195.2167 |
MDL Number: | MFCD00001158 |
SMILES: | Nc1cccc2-c3c(C(=O)c12)cccc3 |
NSC Number: | 51311 |
Complexity: | 276 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 3.5 |
Journal of medicinal chemistry 20110113
Journal of medicinal chemistry 20100923
Chemphyschem : a European journal of chemical physics and physical chemistry 20091207