AB62497
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $7.00 | $5.00 | - + | |
10g | 98% | in stock | $10.00 | $7.00 | - + | |
25g | 98% | in stock | $12.00 | $9.00 | - + | |
100g | 98% | in stock | $45.00 | $32.00 | - + | |
500g | 98% | in stock | $180.00 | $126.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB62497 |
Chemical Name: | 2-Methoxy-5-nitrophenol |
CAS Number: | 636-93-1 |
Molecular Formula: | C7H7NO4 |
Molecular Weight: | 169.1348 |
MDL Number: | MFCD00015561 |
SMILES: | COc1ccc(cc1O)[N+](=O)[O-] |
Complexity: | 167 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.3 |
Chemosphere 20150101
Journal of environmental science and health. Part. B, Pesticides, food contaminants, and agricultural wastes 20110101
Antonie van Leeuwenhoek 20050201
Folia microbiologica 20040101