AG72052
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 97% | in stock | $20.00 | $14.00 | - + | |
5mg | 97% | in stock | $28.00 | $19.00 | - + | |
10mg | 97% | in stock | $33.00 | $23.00 | - + | |
25mg | 97% | in stock | $42.00 | $29.00 | - + | |
50mg | 97% | in stock | $53.00 | $37.00 | - + | |
100mg | 97% | in stock | $69.00 | $48.00 | - + | |
250mg | 97% | in stock | $153.00 | $107.00 | - + | |
1g | 97% | in stock | $530.00 | $371.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG72052 |
Chemical Name: | 2-(4-Hydroxyphenyl)benzo[b]thiophen-6-ol |
CAS Number: | 63676-22-2 |
Molecular Formula: | C14H10O2S |
Molecular Weight: | 242.293 |
MDL Number: | MFCD16619490 |
SMILES: | Oc1ccc(cc1)c1sc2c(c1)ccc(c2)O |
Complexity: | 263 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 3.9 |
Journal of medicinal chemistry 20020328