AB52773
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | 2 weeks | $677.00 | $474.00 | - + | |
250mg | 95% | 2 weeks | $821.00 | $575.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB52773 |
Chemical Name: | 4-chloro-2-[(3-iodophenyl)carbamoylamino]benzoic acid |
CAS Number: | 639009-97-5 |
Molecular Formula: | C14H10ClIN2O3 |
Molecular Weight: | 416.5983 |
MDL Number: | MFCD30533895 |
SMILES: | O=C(Nc1cc(Cl)ccc1C(=O)O)Nc1cccc(c1)I |
Complexity: | 396 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 3 |
XLogP3: | 3.8 |
Journal of medicinal chemistry 20031218