logo
Home  > Glycoursodeoxycholic acid

AB48761

64480-66-6 | Glycoursodeoxycholic acid

Packsize Purity Availability Price Discounted Price    Quantity
100mg ≥98% in stock $42.00 $29.00 -   +
250mg ≥98% in stock $94.00 $66.00 -   +
500mg ≥98% in stock $179.00 $126.00 -   +
1g ≥98% in stock $313.00 $219.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AB48761
Chemical Name: Glycoursodeoxycholic acid
CAS Number: 64480-66-6
Molecular Formula: C26H43NO5
Molecular Weight: 449.6233
MDL Number: MFCD00137427
SMILES: O[C@@H]1CC[C@]2([C@@H](C1)C[C@@H]([C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2[C@@H](CCC(=O)NCC(=O)O)C)C)O)C

 

Upstream Synthesis Route
  • Glycoursodeoxycholic acid, also known as GUDCA, is a versatile compound widely utilized in the field of chemical synthesis due to its unique properties. In chemical synthesis, GUDCA serves as a valuable building block for the creation of various derivatives and intermediate compounds. It can be used as a chiral starting material in the synthesis of complex molecules, making it an essential component in the development of pharmaceuticals, agrochemicals, and other fine chemicals.One of the key applications of GUDCA in chemical synthesis is its role as a protecting group for hydroxyl functionalities. By utilizing GUDCA as a protecting group, chemists can selectively shield hydroxyl groups in a molecule, allowing for specific reactions to occur without unwanted side reactions. This precise control over chemical reactions is crucial for the synthesis of intricate organic compounds with high purity and efficiency.Furthermore, GUDCA can also act as a ligand in metal-catalyzed reactions, facilitating various transformations in organic synthesis. Its unique structure enables it to coordinate with transition metals, increasing the efficiency and selectivity of catalytic processes. This makes GUDCA a valuable tool for chemists in designing novel synthetic pathways and accessing structurally diverse compounds.Overall, the versatile applications of Glycoursodeoxycholic acid in chemical synthesis make it a fundamental building block for the preparation of complex molecules and the advancement of synthetic chemistry methodologies.
FEATURED PRODUCTS