AH08688
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $53.00 | $37.00 | - + | |
250mg | 98% | in stock | $65.00 | $45.00 | - + | |
1g | 98% | in stock | $79.00 | $55.00 | - + | |
5g | 98% | in stock | $236.00 | $165.00 | - + | |
10g | 98% | in stock | $401.00 | $281.00 | - + | |
25g | 98% | in stock | $712.00 | $498.00 | - + | |
100g | 98% | in stock | $1,535.00 | $1,074.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH08688 |
Chemical Name: | 6-Nitro-1H-quinolin-2-one |
CAS Number: | 64495-55-2 |
Molecular Formula: | C9H6N2O3 |
Molecular Weight: | 190.1555 |
MDL Number: | MFCD11501896 |
SMILES: | O=C1CC=c2c(=N1)ccc(c2)[N+](=O)[O-] |
Complexity: | 295 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 1.1 |
European journal of medicinal chemistry 20120801