AI54408
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $39.00 | $27.00 | - + | |
1g | 98% | in stock | $76.00 | $53.00 | - + | |
5g | 98% | in stock | $228.00 | $159.00 | - + | |
25g | 98% | in stock | $1,023.00 | $716.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI54408 |
Chemical Name: | 1,3-Diphenylimidazolidine-2,4,5-trione |
CAS Number: | 6488-59-1 |
Molecular Formula: | C15H10N2O3 |
Molecular Weight: | 266.2515 |
MDL Number: | MFCD00020868 |
SMILES: | O=C1N(c2ccccc2)C(=O)C(=O)N1c1ccccc1 |
NSC Number: | 96058 |
Complexity: | 385 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.6 |
The Journal of organic chemistry 20120106