AB79532
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $19.00 | $13.00 | - + | |
5g | 97% | in stock | $25.00 | $17.00 | - + | |
25g | 97% | in stock | $30.00 | $21.00 | - + | |
100g | 97% | in stock | $53.00 | $38.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB79532 |
Chemical Name: | Tetrafluorophthalic acid |
CAS Number: | 652-03-9 |
Molecular Formula: | C8H2F4O4 |
Molecular Weight: | 238.0927 |
MDL Number: | MFCD00002407 |
SMILES: | OC(=O)c1c(C(=O)O)c(F)c(c(c1F)F)F |
Complexity: | 280 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.4 |
AAPS PharmSciTech 20120601
The Journal of organic chemistry 20070720
Inorganic chemistry 20010312
Inorganic chemistry 20010129