AB71082
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $10.00 | $7.00 | - + | |
10mg | 98% | in stock | $33.00 | $23.00 | - + | |
25mg | 98% | in stock | $62.00 | $43.00 | - + | |
50mg | 98% | in stock | $98.00 | $68.00 | - + | |
100mg | 98% | in stock | $136.00 | $95.00 | - + | |
250mg | 98% | in stock | $179.00 | $125.00 | - + | |
1g | 98% | in stock | $362.00 | $253.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB71082 |
Chemical Name: | BESTATIN HYDROCHLORIDE |
CAS Number: | 65391-42-6 |
Molecular Formula: | C16H25ClN2O4 |
Molecular Weight: | 344.8337 |
MDL Number: | MFCD00058004 |
SMILES: | O[C@H](C(=O)N[C@H](C(=O)O)CC(C)C)[C@@H](Cc1ccccc1)N.Cl |
Complexity: | 367 |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 3 |
Heavy Atom Count: | 23 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 5 |
Rotatable Bond Count: | 8 |
Nature chemical biology 20091001
Journal of medicinal chemistry 20071129