AB60964
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $90.00 | $63.00 | - + | |
1g | 97% | in stock | $106.00 | $75.00 | - + | |
5g | 97% | in stock | $359.00 | $252.00 | - + | |
25g | 97% | in stock | $1,536.00 | $1,075.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB60964 |
Chemical Name: | 5-Bromo-dl-tryptophan |
CAS Number: | 6548-09-0 |
Molecular Formula: | C11H11BrN2O2 |
Molecular Weight: | 283.1212 |
MDL Number: | MFCD00005648 |
SMILES: | NC(C(=O)O)Cc1c[nH]c2c1cc(Br)cc2 |
NSC Number: | 88149 |
Complexity: | 275 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 3 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | -0.1 |
Journal of natural products 20090101
Journal of natural products 20040301
Analytical chemistry 20021215