AI54531
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $325.00 | $228.00 | - + | |
5g | 98% | in stock | $1,257.00 | $880.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI54531 |
Chemical Name: | 3-(2,4-Difluorophenyl)phenol |
CAS Number: | 656304-26-6 |
Molecular Formula: | C12H8F2O |
Molecular Weight: | 206.1881 |
MDL Number: | MFCD16484308 |
SMILES: | Fc1ccc(c(c1)F)c1cccc(c1)O |
Complexity: | 210 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 4.4 |
Journal of medicinal chemistry 20040115