AH20269
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $113.00 | $79.00 | - + | |
5g | 98% | in stock | $417.00 | $292.00 | - + | |
25g | 98% | in stock | $1,535.00 | $1,074.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH20269 |
Chemical Name: | Hydroxydip-tolylborane |
CAS Number: | 66117-64-4 |
Molecular Formula: | C14H15BO |
Molecular Weight: | 210.0793 |
MDL Number: | MFCD09972117 |
SMILES: | OB(c1ccc(cc1)C)c1ccc(cc1)C |
Complexity: | 181 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
The Journal of organic chemistry 20120907