AB44160
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 95% | in stock | $12.00 | $9.00 | - + | |
10g | 95% | in stock | $20.00 | $14.00 | - + | |
25g | 95% | in stock | $39.00 | $28.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB44160 |
Chemical Name: | 2-Methyl-3-nitrobenzotrifluoride |
CAS Number: | 6656-49-1 |
Molecular Formula: | C8H6F3NO2 |
Molecular Weight: | 205.1339 |
MDL Number: | MFCD00042322 |
SMILES: | O=N(=O)c1cccc(c1C)C(F)(F)F |
Complexity: | 224 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 5 |
XLogP3: | 3.3 |
2-Methyl-3-Nitrobenzotrifluoride, also known as 2-Methyl-3-nitrobenzotrifluoride, is a versatile compound widely used in chemical synthesis due to its unique properties and reactivity. This compound is commonly utilized as a key building block in the creation of various organic compounds and pharmaceuticals.In chemical synthesis, 2-Methyl-3-Nitrobenzotrifluoride acts as a valuable intermediate in the production of agrochemicals, pharmaceuticals, and advanced materials. Its trifluoromethyl group enhances the compound's stability and influences its reactivity, making it a desirable starting material for the synthesis of complex molecules. The nitro group also provides opportunities for further functionalization, allowing chemists to tailor the compound for specific applications.Furthermore, 2-Methyl-3-Nitrobenzotrifluoride's structural features make it particularly useful in the development of fluorinated compounds, which have diverse applications in medicinal chemistry, material science, and agrochemical research. Its incorporation into molecules can enhance their biological activity, chemical stability, and physical properties, making it a valuable tool for synthetic chemists working in these areas.Overall, the versatile nature of 2-Methyl-3-Nitrobenzotrifluoride makes it an essential component in the toolkit of organic chemists, enabling the efficient synthesis of a wide range of functionalized compounds with diverse applications in various industries.
Bioscience, biotechnology, and biochemistry 20080801