AB63628
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $13.00 | $9.00 | - + | |
5g | >98% | in stock | $15.00 | $10.00 | - + | |
10g | 98% | in stock | $20.00 | $14.00 | - + | |
100g | 98% | in stock | $112.00 | $79.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB63628 |
Chemical Name: | 1,2,3-Trifluoro-5-nitrobenzene |
CAS Number: | 66684-58-0 |
Molecular Formula: | C6H2F3NO2 |
Molecular Weight: | 177.0808 |
MDL Number: | MFCD00456803 |
SMILES: | [O-][N+](=O)c1cc(F)c(c(c1)F)F |
Complexity: | 172 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 5 |
XLogP3: | 2.2 |
1,2,3-Trifluoro-5-nitrobenzene is a versatile chemical compound widely used in chemical synthesis for various applications. This compound is particularly valuable in organic chemistry due to its unique properties and reactivity.One of the primary applications of 1,2,3-Trifluoro-5-nitrobenzene is as a key building block in the synthesis of pharmaceuticals and agrochemicals. It serves as a valuable precursor for the production of diverse compounds with biological activities, as the trifluoromethyl and nitro functional groups are known to impart desirable properties to the final products.Furthermore, 1,2,3-Trifluoro-5-nitrobenzene is often utilized in the preparation of specialty chemicals, such as dyes, polymers, and materials with specific properties. Its trifluoromethyl and nitro groups can be selectively modified through various chemical transformations, allowing for the tailored synthesis of a wide range of functional molecules.In addition, this compound finds applications in organic synthesis for the construction of complex molecules and the functionalization of aromatic systems. Its unique combination of fluorine and nitro substituents provides chemists with a powerful tool for introducing new functionality and diversity into organic structures.Overall, 1,2,3-Trifluoro-5-nitrobenzene plays a crucial role in modern chemical synthesis, enabling the preparation of diverse compounds with valuable properties for pharmaceutical, agrochemical, and material science applications.