AH21486
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $50.00 | $35.00 | - + | |
250mg | 98% | in stock | $84.00 | $59.00 | - + | |
500mg | 95% | in stock | $145.00 | $102.00 | - + | |
1g | 98% | in stock | $200.00 | $140.00 | - + | |
5g | 98% | in stock | $573.00 | $402.00 | - + | |
10g | 98% | in stock | $946.00 | $662.00 | - + | |
25g | 98% | in stock | $1,879.00 | $1,316.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH21486 |
Chemical Name: | 1,3-Difluoro-5-methoxy-2-nitrobenzene |
CAS Number: | 66684-62-6 |
Molecular Formula: | C7H5F2NO3 |
Molecular Weight: | 189.1163 |
MDL Number: | MFCD09029981 |
SMILES: | COc1cc(F)c(c(c1)F)[N+](=O)[O-] |
Complexity: | 185 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.9 |
1,3-Difluoro-5-methoxy-2-nitrobenzene is a versatile compound that finds extensive application in chemical synthesis due to its unique chemical properties. In organic synthesis, 1,3-Difluoro-5-methoxy-2-nitrobenzene is commonly utilized as a building block for the construction of complex organic molecules. Its trifluoromethyl and nitro functional groups confer reactivity that enables the introduction of fluorine and nitro groups into various organic frameworks. One key application of 1,3-Difluoro-5-methoxy-2-nitrobenzene is in the synthesis of pharmaceutical compounds. The presence of fluorine atoms can enhance the bioavailability and metabolic stability of drug molecules, making this compound valuable in medicinal chemistry. Additionally, the nitro group can serve as a versatile synthetic handle for further functionalization, allowing for the modification of pharmacological properties. Furthermore, 1,3-Difluoro-5-methoxy-2-nitrobenzene is also employed in materials chemistry for the preparation of advanced functional materials. Its fluorinated moiety can impart unique properties such as hydrophobicity and electron-deficient character to materials, making it suitable for applications in areas such as optoelectronics and surface modification. Overall, the strategic incorporation of 1,3-Difluoro-5-methoxy-2-nitrobenzene into chemical synthesis enables the efficient synthesis of diverse organic compounds with tailored properties for applications ranging from drug discovery to material science.