AH15150
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $8.00 | $5.00 | - + | |
1g | 97% | in stock | $10.00 | $7.00 | - + | |
5g | 97% | in stock | $42.00 | $29.00 | - + | |
10g | 97% | in stock | $76.00 | $53.00 | - + | |
25g | 97% | in stock | $98.00 | $68.00 | - + | |
100g | 97% | in stock | $198.00 | $138.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH15150 |
Chemical Name: | 4-(3-Fluoro-benzyloxy)-benzaldehyde |
CAS Number: | 66742-57-2 |
Molecular Formula: | C14H11FO2 |
Molecular Weight: | 230.2343 |
MDL Number: | MFCD02605317 |
SMILES: | O=Cc1ccc(cc1)OCc1cccc(c1)F |
Complexity: | 236 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 4 |
XLogP3: | 2.9 |
European journal of medicinal chemistry 20121001