AH13790
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $155.00 | $108.00 | - + | |
1g | 98% | in stock | $315.00 | $220.00 | - + | |
5g | 98% | in stock | $1,257.00 | $880.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH13790 |
Chemical Name: | 2-(3,5-Dichlorophenyl)benzoic acid |
CAS Number: | 669713-82-0 |
Molecular Formula: | C13H8Cl2O2 |
Molecular Weight: | 267.1074 |
MDL Number: | MFCD03426494 |
SMILES: | Clc1cc(Cl)cc(c1)c1ccccc1C(=O)O |
Complexity: | 273 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 4.1 |
Journal of medicinal chemistry 20040115