AH13172
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | 2 weeks | $221.00 | $155.00 | - + | |
500mg | 95% | 2 weeks | $260.00 | $182.00 | - + | |
1g | 95% | 2 weeks | $328.00 | $230.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH13172 |
Chemical Name: | Proline, 4-fluoro-,labeled with tritium, trans- (9CI) |
CAS Number: | 6745-32-0 |
Molecular Formula: | C10H16F2N2O4 |
Molecular Weight: | 266.2418 |
MDL Number: | MFCD02683983 |
SMILES: | OC(=O)[C@H]1C[C@@H](CN1)F.OC(=O)[C@@H]1C[C@H](CN1)F |