AB77750
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | ≥98% | in stock | $94.00 | $66.00 | - + | |
10mg | ≥98% | in stock | $142.00 | $99.00 | - + | |
25mg | ≥98% | in stock | $255.00 | $179.00 | - + | |
50mg | ≥98% | in stock | $462.00 | $324.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB77750 |
Chemical Name: | JNJ-1661010 |
CAS Number: | 681136-29-8 |
Molecular Formula: | C19H19N5OS |
Molecular Weight: | 365.4521 |
MDL Number: | MFCD00209157 |
SMILES: | O=C(N1CCN(CC1)c1snc(n1)c1ccccc1)Nc1ccccc1 |
Complexity: | 459 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 26 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 3.5 |
Bioorganic & medicinal chemistry letters 20110815
Bioorganic & medicinal chemistry letters 20110415
Bioorganic & medicinal chemistry letters 20101101
Bioorganic & medicinal chemistry letters 20090801
Anesthesia and analgesia 20090101
Molecular pain 20090101
Bioorganic & medicinal chemistry letters 20080901
Cytometry. Part A : the journal of the International Society for Analytical Cytology 20060501