AB48477
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 97% | in stock | $6.00 | $4.00 | - + | |
10g | 97% | in stock | $7.00 | $5.00 | - + | |
25g | 97% | in stock | $15.00 | $11.00 | - + | |
100g | 97% | in stock | $40.00 | $28.00 | - + | |
500g | 97% | in stock | $156.00 | $109.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB48477 |
Chemical Name: | Fmoc-Val-OH |
CAS Number: | 68858-20-8 |
Molecular Formula: | C20H21NO4 |
Molecular Weight: | 339.3850 |
MDL Number: | MFCD00037124 |
SMILES: | O=C(N[C@H](C(=O)O)C(C)C)OCC1c2ccccc2c2c1cccc2 |
Complexity: | 470 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 6 |
XLogP3: | 4 |
European journal of medicinal chemistry 20090501