AH21586
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $356.00 | $249.00 | - + | |
5g | 98% | in stock | $1,288.00 | $902.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH21586 |
Chemical Name: | 1-Cyclopropyl-1,2,3-benzotriazole-5-carboxylic acid |
CAS Number: | 691363-13-0 |
Molecular Formula: | C10H9N3O2 |
Molecular Weight: | 203.1974 |
MDL Number: | MFCD09031746 |
SMILES: | OC(=O)c1ccc2c(c1)nnn2C1CC1 |
Complexity: | 280 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.4 |
Journal of medicinal chemistry 20060223