AY11593
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $7.00 | $5.00 | - + | |
1g | 97% | in stock | $15.00 | $11.00 | - + | |
5g | 97% | in stock | $52.00 | $36.00 | - + | |
25g | 95% | in stock | $200.00 | $140.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AY11593 |
Chemical Name: | 2,7-Di-tert-butylcarbazole |
CAS Number: | 69386-35-2 |
Molecular Formula: | C20H25N |
Molecular Weight: | 279.4192 |
MDL Number: | MFCD32204944 |
SMILES: | CC(c1ccc2c(c1)[nH]c1c2ccc(c1)C(C)(C)C)(C)C |
2,7-Di-tert-butyl-9H-carbazole is a versatile compound widely utilized in chemical synthesis. This unique molecule serves as a valuable building block in the production of various organic compounds. Due to its sterically hindered structure, 2,7-Di-tert-butyl-9H-carbazole is particularly favored in the synthesis of advanced materials such as polymers, organic semiconductors, and pharmaceutical intermediates.In organic synthesis, 2,7-Di-tert-butyl-9H-carbazole is often employed as a stabilizing agent or as a key component in the formation of intricate molecular structures. Its characteristics make it a valuable tool for controlling reactivity and selectivity in a wide range of chemical reactions. Additionally, the presence of tert-butyl groups enhances the compound's thermal and chemical stability, making it suitable for use in demanding synthetic processes.Overall, the application of 2,7-Di-tert-butyl-9H-carbazole in chemical synthesis provides researchers with a powerful tool to access novel compounds and develop innovative technologies in various fields of chemistry.