AB43539
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 90% | in stock | $200.00 | $140.00 | - + | |
1g | 90% | in stock | $583.00 | $408.00 | - + | |
5g | 95% | in stock | $2,019.00 | $1,414.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB43539 |
Chemical Name: | 2,2-diallyl-4,4-biphenol |
CAS Number: | 6942-01-4 |
Molecular Formula: | C18H18O2 |
Molecular Weight: | 266.3343 |
MDL Number: | MFCD11983078 |
SMILES: | C=CCc1cc(ccc1O)c1ccc(c(c1)CC=C)O |
NSC Number: | 57617 |
Complexity: | 293 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
XLogP3: | 5 |
Bioorganic & medicinal chemistry letters 20120101
Journal of medicinal chemistry 20110811
Bioorganic & medicinal chemistry letters 20070815