AB48335
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $6.00 | $4.00 | - + | |
5g | 97% | in stock | $9.00 | $6.00 | - + | |
10g | 97% | in stock | $13.00 | $9.00 | - + | |
25g | 97% | in stock | $28.00 | $19.00 | - + | |
100g | 97% | in stock | $92.00 | $65.00 | - + | |
500g | 97% | in stock | $396.00 | $277.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB48335 |
Chemical Name: | Methyl 2-bromo-5-nitrobenzoate |
CAS Number: | 6942-36-5 |
Molecular Formula: | C8H6BrNO4 |
Molecular Weight: | 260.0415 |
MDL Number: | MFCD00010867 |
SMILES: | COC(=O)c1cc(ccc1Br)[N+](=O)[O-] |
NSC Number: | 57462 |
Complexity: | 240 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 2 |
XLogP3: | 3.3 |
Methyl 2-bromo-5-nitrobenzoate is a versatile compound that finds valuable application in chemical synthesis. This compound serves as a key building block in the creation of various organic molecules due to its unique reactivity and functionality. In chemical synthesis, Methyl 2-bromo-5-nitrobenzoate can be utilized as a precursor in the preparation of pharmaceuticals, agrochemicals, and materials science.Its bromo and nitro functional groups enable it to participate in a variety of substitution reactions, providing opportunities for the introduction of new functional groups and the modification of existing molecular structures. This compound can be used in the synthesis of complex organic molecules through processes such as nucleophilic substitution, palladium-catalyzed coupling reactions, and radical reactions.Overall, Methyl 2-bromo-5-nitrobenzoate plays a crucial role in the field of chemical synthesis by enabling chemists to access a wide range of novel compounds and materials with diverse applications in various industries.