AB60032
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $18.00 | $13.00 | - + | |
1g | 97% | in stock | $24.00 | $17.00 | - + | |
5g | 97% | in stock | $97.00 | $68.00 | - + | |
10g | 98% | in stock | $172.00 | $120.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB60032 |
Chemical Name: | 2,4,6-Trichloropyridine-3-carboxylic acid |
CAS Number: | 69422-72-6 |
Molecular Formula: | C6H2Cl3NO2 |
Molecular Weight: | 226.4446 |
MDL Number: | MFCD09038102 |
SMILES: | Clc1cc(Cl)c(c(n1)Cl)C(=O)O |
Complexity: | 190 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.9 |
2,4,6-Trichloronicotinic acid, also known as TCA, is a valuable chemical compound with a wide range of applications in chemical synthesis. As a versatile building block, TCA is commonly used in the pharmaceutical and agrochemical industries to synthesize a variety of biologically active compounds. Due to its unique reactivity and functional groups, TCA serves as a key intermediate in the production of herbicides, pesticides, and pharmaceutical drugs. In chemical synthesis, TCA can undergo various types of reactions, such as condensation, alkylation, and esterification, to yield complex molecules with specific properties and functionalities. Its ability to introduce chlorinated substituents onto aromatic rings makes TCA particularly valuable in designing novel organic compounds with desired biological activities. Furthermore, the presence of multiple chlorine atoms in TCA enhances its electron-withdrawing capabilities, thereby influencing the overall reactivity and stability of the synthesized products. Overall, the strategic incorporation of 2,4,6-Trichloronicotinic acid in chemical synthesis plays a crucial role in the development of innovative materials and compounds with diverse industrial applications.