AB43782
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $12.00 | $8.00 | - + | |
5g | 98% | in stock | $13.00 | $9.00 | - + | |
25g | 98% | in stock | $25.00 | $17.00 | - + | |
100g | 95% | in stock | $61.00 | $43.00 | - + | |
500g | 95% | in stock | $273.00 | $191.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB43782 |
Chemical Name: | 2-Amino-5-bromo-3-nitropyridine |
CAS Number: | 6945-68-2 |
Molecular Formula: | C5H4BrN3O2 |
Molecular Weight: | 218.0082 |
MDL Number: | MFCD00047441 |
SMILES: | Brc1cnc(c(c1)[N+](=O)[O-])N |
NSC Number: | 52200 |
Complexity: | 160 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 1.6 |
2-Amino-5-Bromo-3-Nitropyridine, a versatile compound frequently utilized in chemical synthesis, plays a crucial role in the development of novel pharmaceuticals and agrochemicals. Its inherent reactivity allows for efficient functional group transformations, making it a valuable building block in the synthesis of complex organic molecules. Specifically, 2-Amino-5-Bromo-3-Nitropyridine is commonly employed as a key intermediate in the construction of heterocyclic structures, which are essential in drug discovery and crop protection research. By serving as a strategic starting material, this compound enables chemists to access a wide variety of substituted pyridine derivatives with diverse biological activities. Its utility extends to the synthesis of organic dyes, materials science applications, and as a precursor for ligand design in coordination chemistry. In summary, the versatile nature of 2-Amino-5-Bromo-3-Nitropyridine makes it a valuable tool in the arsenal of synthetic chemists seeking to innovate in the field of chemical synthesis.