AB70139
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $10.00 | $7.00 | - + | |
1g | 97% | in stock | $16.00 | $11.00 | - + | |
5g | 97% | in stock | $40.00 | $28.00 | - + | |
25g | 98% | in stock | $187.00 | $131.00 | - + | |
100g | 98% | in stock | $573.00 | $402.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB70139 |
Chemical Name: | 7-Hydroxycoumarin-4-acetic acid |
CAS Number: | 6950-82-9 |
Molecular Formula: | C11H8O5 |
Molecular Weight: | 220.1782 |
MDL Number: | MFCD00037563 |
SMILES: | OC(=O)Cc1cc(=O)oc2c1ccc(c2)O |
Complexity: | 346 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 1 |
Bioorganic & medicinal chemistry letters 20101001
Beilstein journal of organic chemistry 20100101
Molecules (Basel, Switzerland) 20090710
Nature chemical biology 20071001
Molecules (Basel, Switzerland) 20060307
The Biochemical journal 20020501
Analytical biochemistry 20010801