AB70180
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 97% | in stock | $8.00 | $5.00 | - + | |
25mg | 97% | in stock | $9.00 | $6.00 | - + | |
50mg | 97% | in stock | $12.00 | $8.00 | - + | |
250mg | 97% | in stock | $28.00 | $19.00 | - + | |
1g | 97% | in stock | $36.00 | $25.00 | - + | |
5g | 97% | in stock | $102.00 | $71.00 | - + | |
25g | 97% | in stock | $476.00 | $333.00 | - + | |
100g | 97% | in stock | $1,878.00 | $1,315.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB70180 |
Chemical Name: | 7-Nitroindole-2-carboxylic acid |
CAS Number: | 6960-45-8 |
Molecular Formula: | C9H6N2O4 |
Molecular Weight: | 206.1549 |
MDL Number: | MFCD00044720 |
SMILES: | [O-][N+](=O)c1cccc2c1[nH]c(c2)C(=O)O |
NSC Number: | 69877 |
Complexity: | 288 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.7 |
Journal of medicinal chemistry 20120412
PloS one 20110101
Science (New York, N.Y.) 20100702
Analytical chemistry 20100215
Journal of radiation research 20100101
PloS one 20090101