AC72426
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $22.00 | $15.00 | - + | |
5g | 97% | in stock | $43.00 | $30.00 | - + | |
100g | 97% | in stock | $667.00 | $467.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC72426 |
Chemical Name: | 6-Amino-1-methyl-5-nitrosouracil |
CAS Number: | 6972-78-7 |
Molecular Formula: | C5H6N4O3 |
Molecular Weight: | 170.1261 |
MDL Number: | MFCD01104056 |
SMILES: | O=Nc1c(=O)[nH]c(=O)n(c1N)C |
NSC Number: | 62582 |
Complexity: | 295 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
XLogP3: | -1.1 |
Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy 20100101
Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy 20041101