logo
Home  > Chemistry  > Heterocyclic Building Blocks  > Pyridines  > 2-Amino-4-chloro-3-nitropyridine

AH15697

6980-08-1 | 2-Amino-4-chloro-3-nitropyridine

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $22.00 $15.00 -   +
5g 95% in stock $40.00 $28.00 -   +
10g 95% in stock $64.00 $45.00 -   +
25g 95% in stock $110.00 $77.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AH15697
Chemical Name: 2-Amino-4-chloro-3-nitropyridine
CAS Number: 6980-08-1
Molecular Formula: C5H4ClN3O2
Molecular Weight: 173.55716
MDL Number: MFCD04116097
SMILES: [O-][N+](=O)c1c(Cl)ccnc1N

 

Computed Properties
Complexity: 160  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 11  
Hydrogen Bond Acceptor Count: 4  
Hydrogen Bond Donor Count: 1  
XLogP3: 1.5  

 

 

Upstream Synthesis Route
  • 4-Chloro-3-nitropyridin-2-amine, also known as $name$, serves as a crucial building block in the field of chemical synthesis. This compound is often utilized for its remarkable reactivity and versatility in organic reactions.In chemical synthesis, $name$ plays a key role as a valuable intermediate in the preparation of various pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure and functional groups make it a valuable starting material for the synthesis of complex molecules with specific biological or industrial applications.One common application of 4-Chloro-3-nitropyridin-2-amine is in the formation of heterocyclic compounds, which are essential in the development of new drug candidates and advanced materials. By utilizing this compound as a precursor, chemists can introduce specific functional groups and manipulate the molecular structure to design molecules with desired properties.Additionally, the presence of the chlorine and nitro groups in 4-Chloro-3-nitropyridin-2-amine enables selective transformations through various chemical reactions such as nucleophilic substitution, reduction, and metal-catalyzed coupling reactions. This versatility allows chemists to tailor the molecular properties of the final product for specific applications in the pharmaceutical and agrochemical industries.Overall, the strategic use of 4-Chloro-3-nitropyridin-2-amine in chemical synthesis offers a pathway to access diverse chemical space and facilitate the discovery and development of novel compounds with potential therapeutic, agricultural, or industrial significance.
FEATURED PRODUCTS