AB42698
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10g | 95% | in stock | $10.00 | $7.00 | - + | |
25g | 95% | in stock | $16.00 | $11.00 | - + | |
500g | 95% | in stock | $207.00 | $145.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB42698 |
Chemical Name: | 2,7-Dichlorofluorene |
CAS Number: | 7012-16-0 |
Molecular Formula: | C13H8Cl2 |
Molecular Weight: | 235.1086 |
MDL Number: | MFCD00032840 |
SMILES: | Clc1ccc2-c3c(Cc2c1)cc(cc3)Cl |
NSC Number: | 73077 |
Complexity: | 217 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
XLogP3: | 4.9 |
Environmental toxicology and chemistry 20120301