AB52612
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $27.00 | $19.00 | - + | |
250mg | 95% | in stock | $30.00 | $21.00 | - + | |
1g | 95% | in stock | $60.00 | $42.00 | - + | |
5g | 95% | in stock | $182.00 | $127.00 | - + | |
25g | 95% | in stock | $546.00 | $382.00 | - + | |
100g | 95% | in stock | $1,909.00 | $1,336.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB52612 |
Chemical Name: | 4-(Phenylsulfonyl)aniline |
CAS Number: | 7019-01-4 |
Molecular Formula: | C12H11NO2S |
Molecular Weight: | 233.2862 |
MDL Number: | MFCD00625703 |
SMILES: | Nc1ccc(cc1)S(=O)(=O)c1ccccc1 |
Complexity: | 306 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.8 |
Journal of medicinal chemistry 20040101
Acta microbiologica et immunologica Hungarica 20030101
Archiv der Pharmazie 20020401