AB65166
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $16.00 | $11.00 | - + | |
1g | 95% | in stock | $23.00 | $16.00 | - + | |
5g | 95% | in stock | $50.00 | $35.00 | - + | |
10g | 95% | in stock | $65.00 | $45.00 | - + | |
25g | 95% | in stock | $71.00 | $50.00 | - + | |
100g | 95% | in stock | $235.00 | $165.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB65166 |
Chemical Name: | 3-Iodo-6-nitro-1h-indazole |
CAS Number: | 70315-70-7 |
Molecular Formula: | C7H4IN3O2 |
Molecular Weight: | 289.03002999999995 |
MDL Number: | MFCD07781652 |
SMILES: | [O-][N+](=O)c1ccc2c(c1)[nH]nc2I |
Complexity: | 220 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 2.1 |
3-Iodo-6-nitro-1H-indazole is a versatile compound used in chemical synthesis for various applications. One of the key uses of 3-Iodo-6-nitro-1H-indazole is as a building block in the synthesis of pharmaceutical compounds. Its unique structure and reactivity make it an important intermediate in the production of a wide range of pharmaceuticals.Furthermore, 3-Iodo-6-nitro-1H-indazole is commonly employed in the synthesis of heterocyclic compounds. Its presence in a reaction can facilitate the formation of complex ring structures with diverse functionalities. This property makes it a valuable tool for organic chemists working on the creation of new molecules with potential biological activity.Additionally, 3-Iodo-6-nitro-1H-indazole can be utilized in the preparation of dyes and pigments. Its ability to undergo various chemical transformations allows for the modification of its color properties, making it a useful component in the creation of vibrant and stable colorants.Overall, 3-Iodo-6-nitro-1H-indazole plays a crucial role in the realm of chemical synthesis, enabling the construction of intricate molecules with diverse applications in pharmaceuticals, materials science, and other fields.