AH12652
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $22.00 | $15.00 | - + | |
250mg | 95% | in stock | $39.00 | $28.00 | - + | |
1g | 95% | in stock | $114.00 | $80.00 | - + | |
5g | 95% | in stock | $235.00 | $165.00 | - + | |
10g | 95% | in stock | $323.00 | $226.00 | - + | |
25g | 95% | in stock | $620.00 | $434.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH12652 |
Chemical Name: | 2-Methyldiphenylmethane |
CAS Number: | 713-36-0 |
Molecular Formula: | C12H22N2O5 |
Molecular Weight: | 274.3135 |
MDL Number: | MFCD00270116 |
SMILES: | O=C(NCCCC(=O)O)CCNC(=O)OC(C)(C)C |
NSC Number: | 75366 |
Complexity: | 155 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Rotatable Bond Count: | 2 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 4.7 |
Journal of mass spectrometry : JMS 20120701
Inorganic chemistry 20120507