AH13995
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $510.00 | $357.00 | - + | |
1g | 98% | in stock | $1,488.00 | $1,042.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH13995 |
Chemical Name: | 2-(Pyridin-2-yl)benzothiazole |
CAS Number: | 716-80-3 |
Molecular Formula: | C12H8N2S |
Molecular Weight: | 212.2703 |
MDL Number: | MFCD00454843 |
SMILES: | c1ccc(nc1)c1nc2c(s1)cccc2 |
NSC Number: | 62611 |
Complexity: | 222 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 1 |
XLogP3: | 3 |
Dalton transactions (Cambridge, England : 2003) 20121114
Bioorganic & medicinal chemistry letters 20120701
Inorganic chemistry 20080505
Cytometry. Part A : the journal of the International Society for Analytical Cytology 20060501
Inorganic chemistry 20060123
Inorganic chemistry 20050516
Journal of agricultural and food chemistry 20050209
Inorganic chemistry 20040809
Inorganic chemistry 20020506