AB68802
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $33.00 | $23.00 | - + | |
5g | 95% | in stock | $35.00 | $24.00 | - + | |
25g | 95% | in stock | $113.00 | $79.00 | - + | |
500g | 95% | in stock | $2,002.00 | $1,402.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB68802 |
Chemical Name: | 5-Aminoorotic acid |
CAS Number: | 7164-43-4 |
Molecular Formula: | C5H5N3O4 |
Molecular Weight: | 171.1109 |
MDL Number: | MFCD00010563 |
SMILES: | O=c1[nH]c(=O)c(c([nH]1)C(=O)O)N |
NSC Number: | 43249 |
Complexity: | 306 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 1 |
XLogP3: | -1.2 |
Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy 20121101
European journal of medicinal chemistry 20101201
Drug metabolism and disposition: the biological fate of chemicals 20080901
Medicinal chemistry (Shariqah (United Arab Emirates)) 20080701
Bioinorganic chemistry and applications 20080101
Archiv der Pharmazie 20061101
Journal of chromatography. A 20060224