AH13178
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98+% | in stock | $58.00 | $41.00 | - + | |
10mg | 98+% | in stock | $219.00 | $154.00 | - + | |
50mg | ≥98% | in stock | $874.00 | $612.00 | - + | |
100mg | ≥98% | in stock | $1,534.00 | $1,074.00 | - + | |
1000mg | 98% by HPLC | in stock | $14,522.00 | $10,165.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH13178 |
Chemical Name: | N-[3-[[[2-[(2,3-Dihydro-2-oxo-1h-indol-5-yl)amino]-5-(trifluoromethyl)-4-pyrimidinyl]amino]methyl]-2-pyridinyl]-n-methyl-methanesulfonamide |
CAS Number: | 717907-75-0 |
Molecular Formula: | C21H20F3N7O3S |
Molecular Weight: | 507.4888 |
MDL Number: | MFCD16038299 |
SMILES: | O=C1Nc2c(C1)cc(cc2)Nc1ncc(c(n1)NCc1cccnc1N(S(=O)(=O)C)C)C(F)(F)F |
Complexity: | 856 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 35 |
Hydrogen Bond Acceptor Count: | 12 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 7 |
XLogP3: | 2 |
Bioorganic & medicinal chemistry letters 20130801
International journal of cancer 20120715
Journal of medicinal chemistry 20120614
Arthritis and rheumatism 20120501
Molecular cancer therapeutics 20111101
Anti-cancer agents in medicinal chemistry 20110901
Oncogene 20101209
Cancer biology & therapy 20100701
Journal of medicinal chemistry 20100610
Cancer biology & therapy 20090501
Breast cancer research : BCR 20090101
Cancer 20080515
Cancer research 20080315