AB48472
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $7.00 | $5.00 | - + | |
10g | 98% | in stock | $10.00 | $7.00 | - + | |
25g | 98% | in stock | $13.00 | $9.00 | - + | |
100g | 98% | in stock | $45.00 | $32.00 | - + | |
500g | 98% | in stock | $201.00 | $141.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB48472 |
Chemical Name: | Fmoc-Ile-OH |
CAS Number: | 71989-23-6 |
Molecular Formula: | C21H23NO4 |
Molecular Weight: | 353.4116 |
MDL Number: | MFCD00037125 |
SMILES: | CC[C@@H]([C@@H](C(=O)O)NC(=O)OCC1c2ccccc2c2c1cccc2)C |
Complexity: | 486 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 26 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 7 |
XLogP3: | 4.4 |
Journal of chromatography. A 20110916
European journal of medicinal chemistry 20090501