logo
Home  > Life Science  > Amino acids  > Amino acid derivatives  > Fmoc-Thr(tBu)-OH

AB46184

71989-35-0 | Fmoc-Thr(tBu)-OH

Packsize Purity Availability Price Discounted Price    Quantity
5g 99% in stock $8.00 $5.00 -   +
10g 99% in stock $12.00 $8.00 -   +
25g 99% in stock $23.00 $16.00 -   +
100g 99% in stock $75.00 $52.00 -   +
250g 99% in stock $178.00 $124.00 -   +
500g 99% in stock $339.00 $237.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AB46184
Chemical Name: Fmoc-Thr(tBu)-OH
CAS Number: 71989-35-0
Molecular Formula: C23H27NO5
Molecular Weight: 397.4642
MDL Number: MFCD00077075
SMILES: O=C(N[C@@H]([C@H](OC(C)(C)C)C)C(=O)O)OCC1c2ccccc2-c2c1cccc2

 

Computed Properties
Complexity: 564  
Covalently-Bonded Unit Count: 1  
Defined Atom Stereocenter Count: 2  
Heavy Atom Count: 29  
Hydrogen Bond Acceptor Count: 5  
Hydrogen Bond Donor Count: 2  
Rotatable Bond Count: 8  
XLogP3: 4  

 

 

Upstream Synthesis Route
  • (2S,3R)-2-(((9-Fluorenylmethoxy)carbonyl)amino)-3-(tert-butoxy)butanoic acid is a versatile compound widely used in chemical synthesis processes. Known for its unique stereochemistry and functional groups, this compound plays a crucial role in peptide synthesis and modification.In peptide chemistry, (2S,3R)-2-(((9-Fluorenylmethoxy)carbonyl)amino)-3-(tert-butoxy)butanoic acid serves as a key building block for creating peptide chains. Its amino and carboxylic acid groups enable it to participate in peptide bond formation, leading to the development of diverse peptide structures.Additionally, the tert-butoxy and fluorenylmethoxy carbonyl (Fmoc) protecting groups present in this compound offer strategic protection and selective deprotection during peptide assembly. These groups assist in controlling the reactivity and specificity of chemical reactions, allowing for precise manipulation of peptide sequences.Moreover, the (2S,3R) stereochemistry of this compound imparts chirality, making it valuable in the synthesis of enantiopure compounds. By incorporating (2S,3R)-2-(((9-Fluorenylmethoxy)carbonyl)amino)-3-(tert-butoxy)butanoic acid into chemical reactions, chemists can access chiral motifs essential for pharmaceuticals, agrochemicals, and materials science.Overall, (2S,3R)-2-(((9-Fluorenylmethoxy)carbonyl)amino)-3-(tert-butoxy)butanoic acid serves as a fundamental building block in chemical synthesis, facilitating the creation of complex molecules with tailored functionalities and stereochemistries. Its strategic role in peptide chemistry and chiral synthesis makes it a valuable tool for researchers and synthetic chemists striving to develop innovative compounds.
FEATURED PRODUCTS